C28H30O6 — CID 126551897
[3-[3-[[4-(3,3-dimethylbutanoyl)-3-hydroxy-2-methylphenoxy]methyl]phenyl]-4-methoxyphenyl] formate (PubChem CID 126551897) has the molecular formula C28H30O6 and a molecular weight of 462.54 g/mol. Its IUPAC name is [3-[3-[[4-(3,3-dimethylbutanoyl)-3-hydroxy-2-methylphenoxy]methyl]phenyl]-4-methoxyphenyl] formate.
| Compound Name | [3-[3-[[4-(3,3-dimethylbutanoyl)-3-hydroxy-2-methylphenoxy]methyl]phenyl]-4-methoxyphenyl] formate |
|---|---|
| PubChem CID | 126551897 |
| Molecular Formula | C28H30O6 |
| Molecular Weight | 462.54 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | [3-[3-[[4-(3,3-dimethylbutanoyl)-3-hydroxy-2-methylphenoxy]methyl]phenyl]-4-methoxyphenyl] formate |
| SMILES | COc1ccc(OC=O)cc1-c1cccc(COc2ccc(C(=O)CC(C)(C)C)c(O)c2C)c1 |
| InChI | InChI=1S/C28H30O6/c1-18-25(12-10-22(27(18)31)24(30)15-28(2,3)4)33-16-19-7-6-8-20(13-19)23-14-21(34-17-29)9-11-26(23)32-5/h6-14,17,31H,15-16H2,1-5H3 |
| InChIKey | JSHHJUZKPMAYMS-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.54 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|