C27H31NO5 — CID 135215826
(Z)-3-[3-[[4-(3,3-dimethylbutanoyl)-3-hydroxy-2-methylphenoxy]methyl]phenyl]-2-[(Z)-2-(methylideneamino)ethenyl]but-2-enoic acid (PubChem CID 135215826) has the molecular formula C27H31NO5 and a molecular weight of 449.55 g/mol. Its IUPAC name is (Z)-3-[3-[[4-(3,3-dimethylbutanoyl)-3-hydroxy-2-methylphenoxy]methyl]phenyl]-2-[(Z)-2-(methylideneamino)ethenyl]but-2-enoic acid.
| Compound Name | (Z)-3-[3-[[4-(3,3-dimethylbutanoyl)-3-hydroxy-2-methylphenoxy]methyl]phenyl]-2-[(Z)-2-(methylideneamino)ethenyl]but-2-enoic acid |
|---|---|
| PubChem CID | 135215826 |
| Molecular Formula | C27H31NO5 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | (Z)-3-[3-[[4-(3,3-dimethylbutanoyl)-3-hydroxy-2-methylphenoxy]methyl]phenyl]-2-[(Z)-2-(methylideneamino)ethenyl]but-2-enoic acid |
| SMILES | C=N/C=C\C(C(=O)O)=C(/C)c1cccc(COc2ccc(C(=O)CC(C)(C)C)c(O)c2C)c1 |
| InChI | InChI=1S/C27H31NO5/c1-17(21(26(31)32)12-13-28-6)20-9-7-8-19(14-20)16-33-24-11-10-22(25(30)18(24)2)23(29)15-27(3,4)5/h7-14,30H,6,15-16H2,1-5H3,(H,31,32)/b13-12-,21-17- |
| InChIKey | MJTOEIVGPQFGMA-GEBAUQKFSA-N |
| XLogP | 5.97 |
| TPSA | 96.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|