C23H30O3S — CID 176768271
1-[2-hydroxy-3-methyl-4-(4-phenylsulfanylbutoxy)phenyl]-3,3-dimethylbutan-1-one (PubChem CID 176768271) has the molecular formula C23H30O3S and a molecular weight of 386.56 g/mol. Its IUPAC name is 1-[2-hydroxy-3-methyl-4-(4-phenylsulfanylbutoxy)phenyl]-3,3-dimethylbutan-1-one.
| Compound Name | 1-[2-hydroxy-3-methyl-4-(4-phenylsulfanylbutoxy)phenyl]-3,3-dimethylbutan-1-one |
|---|---|
| PubChem CID | 176768271 |
| Molecular Formula | C23H30O3S |
| Molecular Weight | 386.56 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | 1-[2-hydroxy-3-methyl-4-(4-phenylsulfanylbutoxy)phenyl]-3,3-dimethylbutan-1-one |
| SMILES | Cc1c(OCCCCSc2ccccc2)ccc(C(=O)CC(C)(C)C)c1O |
| InChI | InChI=1S/C23H30O3S/c1-17-21(13-12-19(22(17)25)20(24)16-23(2,3)4)26-14-8-9-15-27-18-10-6-5-7-11-18/h5-7,10-13,25H,8-9,14-16H2,1-4H3 |
| InChIKey | IFHXRVJWSDEZBX-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.56 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|