C23H28O8 — CID 176768268
3-[[4-(3,3-dimethylbutanoyl)-3-hydroxy-2-methylphenoxy]methoxy]-2,4-dimethoxybenzoic acid (PubChem CID 176768268) has the molecular formula C23H28O8 and a molecular weight of 432.47 g/mol. Its IUPAC name is 3-[[4-(3,3-dimethylbutanoyl)-3-hydroxy-2-methylphenoxy]methoxy]-2,4-dimethoxybenzoic acid.
| Compound Name | 3-[[4-(3,3-dimethylbutanoyl)-3-hydroxy-2-methylphenoxy]methoxy]-2,4-dimethoxybenzoic acid |
|---|---|
| PubChem CID | 176768268 |
| Molecular Formula | C23H28O8 |
| Molecular Weight | 432.47 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | 3-[[4-(3,3-dimethylbutanoyl)-3-hydroxy-2-methylphenoxy]methoxy]-2,4-dimethoxybenzoic acid |
| SMILES | COc1ccc(C(=O)O)c(OC)c1OCOc1ccc(C(=O)CC(C)(C)C)c(O)c1C |
| InChI | InChI=1S/C23H28O8/c1-13-17(9-7-14(19(13)25)16(24)11-23(2,3)4)30-12-31-21-18(28-5)10-8-15(22(26)27)20(21)29-6/h7-10,25H,11-12H2,1-6H3,(H,26,27) |
| InChIKey | YMTGQIJCJXRROG-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.47 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|