C22H31N5O3 — CID 142867042
4-[4-(4-acetyl-3-hydroxy-2-propylphenoxy)butylamino]-N'-hydrazinylbenzenecarboximidamide (PubChem CID 142867042) has the molecular formula C22H31N5O3 and a molecular weight of 413.52 g/mol. Its IUPAC name is 4-[4-(4-acetyl-3-hydroxy-2-propylphenoxy)butylamino]-N'-hydrazinylbenzenecarboximidamide.
| Compound Name | 4-[4-(4-acetyl-3-hydroxy-2-propylphenoxy)butylamino]-N'-hydrazinylbenzenecarboximidamide |
|---|---|
| PubChem CID | 142867042 |
| Molecular Formula | C22H31N5O3 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.24 |
| IUPAC Name | 4-[4-(4-acetyl-3-hydroxy-2-propylphenoxy)butylamino]-N'-hydrazinylbenzenecarboximidamide |
| SMILES | CCCc1c(OCCCCNc2ccc(/C(N)=N/NN)cc2)ccc(C(C)=O)c1O |
| InChI | InChI=1S/C22H31N5O3/c1-3-6-19-20(12-11-18(15(2)28)21(19)29)30-14-5-4-13-25-17-9-7-16(8-10-17)22(23)26-27-24/h7-12,25,27,29H,3-6,13-14,24H2,1-2H3,(H2,23,26) |
| InChIKey | AOWAKGNIXYFUEJ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 134.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|