C14H16BrF3O3 — CID 19876974
1-[4-(3-bromopropoxy)-2-hydroxy-3-propylphenyl]-2,2,2-trifluoroethanone (PubChem CID 19876974) has the molecular formula C14H16BrF3O3 and a molecular weight of 369.18 g/mol. Its IUPAC name is 1-[4-(3-bromopropoxy)-2-hydroxy-3-propylphenyl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[4-(3-bromopropoxy)-2-hydroxy-3-propylphenyl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 19876974 |
| Molecular Formula | C14H16BrF3O3 |
| Molecular Weight | 369.18 g/mol |
| Exact Mass | 368.02 |
| IUPAC Name | 1-[4-(3-bromopropoxy)-2-hydroxy-3-propylphenyl]-2,2,2-trifluoroethanone |
| SMILES | CCCc1c(OCCCBr)ccc(C(=O)C(F)(F)F)c1O |
| InChI | InChI=1S/C14H16BrF3O3/c1-2-4-9-11(21-8-3-7-15)6-5-10(12(9)19)13(20)14(16,17)18/h5-6,19H,2-4,7-8H2,1H3 |
| InChIKey | KJPIXTONJYFGSO-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.18 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|