C20H23F3N4O4 — CID 143505309
2-[3-[3-hydroxy-2-propyl-4-(2,2,2-trifluoroethanimidoyl)phenoxy]propyl-methylamino]pyrimidine-5-carboxylic acid (PubChem CID 143505309) has the molecular formula C20H23F3N4O4 and a molecular weight of 440.42 g/mol. Its IUPAC name is 2-[3-[3-hydroxy-2-propyl-4-(2,2,2-trifluoroethanimidoyl)phenoxy]propyl-methylamino]pyrimidine-5-carboxylic acid.
| Compound Name | 2-[3-[3-hydroxy-2-propyl-4-(2,2,2-trifluoroethanimidoyl)phenoxy]propyl-methylamino]pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 143505309 |
| Molecular Formula | C20H23F3N4O4 |
| Molecular Weight | 440.42 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | 2-[3-[3-hydroxy-2-propyl-4-(2,2,2-trifluoroethanimidoyl)phenoxy]propyl-methylamino]pyrimidine-5-carboxylic acid |
| SMILES | [H]/N=C(/c1ccc(OCCCN(C)c2ncc(C(=O)O)cn2)c(CCC)c1O)C(F)(F)F |
| InChI | InChI=1S/C20H23F3N4O4/c1-3-5-13-15(7-6-14(16(13)28)17(24)20(21,22)23)31-9-4-8-27(2)19-25-10-12(11-26-19)18(29)30/h6-7,10-11,24,28H,3-5,8-9H2,1-2H3,(H,29,30)/b24-17- |
| InChIKey | HHNOPAYDPZHHDN-ULJHMMPZSA-N |
| XLogP | 3.67 |
| TPSA | 119.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.42 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|