C22H26F3N3O4 — CID 143505333
2-[6-[3-[3-hydroxy-2-propyl-4-(2,2,2-trifluoroethanimidoyl)phenoxy]propyl-methylamino]-3-pyridinyl]acetic acid (PubChem CID 143505333) has the molecular formula C22H26F3N3O4 and a molecular weight of 453.46 g/mol. Its IUPAC name is 2-[6-[3-[3-hydroxy-2-propyl-4-(2,2,2-trifluoroethanimidoyl)phenoxy]propyl-methylamino]-3-pyridinyl]acetic acid.
| Compound Name | 2-[6-[3-[3-hydroxy-2-propyl-4-(2,2,2-trifluoroethanimidoyl)phenoxy]propyl-methylamino]-3-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 143505333 |
| Molecular Formula | C22H26F3N3O4 |
| Molecular Weight | 453.46 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | 2-[6-[3-[3-hydroxy-2-propyl-4-(2,2,2-trifluoroethanimidoyl)phenoxy]propyl-methylamino]-3-pyridinyl]acetic acid |
| SMILES | [H]/N=C(/c1ccc(OCCCN(C)c2ccc(CC(=O)O)cn2)c(CCC)c1O)C(F)(F)F |
| InChI | InChI=1S/C22H26F3N3O4/c1-3-5-15-17(8-7-16(20(15)31)21(26)22(23,24)25)32-11-4-10-28(2)18-9-6-14(13-27-18)12-19(29)30/h6-9,13,26,31H,3-5,10-12H2,1-2H3,(H,29,30)/b26-21- |
| InChIKey | XIOHNEMHCZEOMA-QLYXXIJNSA-N |
| XLogP | 4.20 |
| TPSA | 106.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.46 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|