C24H28BrF3N2O4 — CID 143505405
ethyl 2-bromo-4-[3-[3-hydroxy-2-propyl-4-(2,2,2-trifluoroethanimidoyl)phenoxy]propyl-methylamino]benzoate (PubChem CID 143505405) has the molecular formula C24H28BrF3N2O4 and a molecular weight of 545.40 g/mol. Its IUPAC name is ethyl 2-bromo-4-[3-[3-hydroxy-2-propyl-4-(2,2,2-trifluoroethanimidoyl)phenoxy]propyl-methylamino]benzoate.
| Compound Name | ethyl 2-bromo-4-[3-[3-hydroxy-2-propyl-4-(2,2,2-trifluoroethanimidoyl)phenoxy]propyl-methylamino]benzoate |
|---|---|
| PubChem CID | 143505405 |
| Molecular Formula | C24H28BrF3N2O4 |
| Molecular Weight | 545.40 g/mol |
| Exact Mass | 544.12 |
| IUPAC Name | ethyl 2-bromo-4-[3-[3-hydroxy-2-propyl-4-(2,2,2-trifluoroethanimidoyl)phenoxy]propyl-methylamino]benzoate |
| SMILES | [H]/N=C(/c1ccc(OCCCN(C)c2ccc(C(=O)OCC)c(Br)c2)c(CCC)c1O)C(F)(F)F |
| InChI | InChI=1S/C24H28BrF3N2O4/c1-4-7-17-20(11-10-18(21(17)31)22(29)24(26,27)28)34-13-6-12-30(3)15-8-9-16(19(25)14-15)23(32)33-5-2/h8-11,14,29,31H,4-7,12-13H2,1-3H3/b29-22- |
| InChIKey | NIRMQMPMPLTUIP-IADYIPOJSA-N |
| XLogP | 6.12 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.40 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|