C20H25F3N4O3 — CID 162583331
3-[3-[[5-(hydroxymethyl)pyrimidin-2-yl]-methylamino]propoxy]-2-propyl-6-(2,2,2-trifluoroethanimidoyl)phenol (PubChem CID 162583331) has the molecular formula C20H25F3N4O3 and a molecular weight of 426.44 g/mol. Its IUPAC name is 3-[3-[[5-(hydroxymethyl)pyrimidin-2-yl]-methylamino]propoxy]-2-propyl-6-(2,2,2-trifluoroethanimidoyl)phenol.
| Compound Name | 3-[3-[[5-(hydroxymethyl)pyrimidin-2-yl]-methylamino]propoxy]-2-propyl-6-(2,2,2-trifluoroethanimidoyl)phenol |
|---|---|
| PubChem CID | 162583331 |
| Molecular Formula | C20H25F3N4O3 |
| Molecular Weight | 426.44 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | 3-[3-[[5-(hydroxymethyl)pyrimidin-2-yl]-methylamino]propoxy]-2-propyl-6-(2,2,2-trifluoroethanimidoyl)phenol |
| SMILES | [H]/N=C(/c1ccc(OCCCN(C)c2ncc(CO)cn2)c(CCC)c1O)C(F)(F)F |
| InChI | InChI=1S/C20H25F3N4O3/c1-3-5-14-16(7-6-15(17(14)29)18(24)20(21,22)23)30-9-4-8-27(2)19-25-10-13(12-28)11-26-19/h6-7,10-11,24,28-29H,3-5,8-9,12H2,1-2H3/b24-18- |
| InChIKey | MGPWLVJCCQDJMD-MOHJPFBDSA-N |
| XLogP | 3.46 |
| TPSA | 102.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.44 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|