C23H27F3N2O4 — CID 143505377
methyl 4-[3-[3-hydroxy-2-propyl-4-(2,2,2-trifluoroethanimidoyl)phenoxy]propyl-methylamino]benzoate (PubChem CID 143505377) has the molecular formula C23H27F3N2O4 and a molecular weight of 452.47 g/mol. Its IUPAC name is methyl 4-[3-[3-hydroxy-2-propyl-4-(2,2,2-trifluoroethanimidoyl)phenoxy]propyl-methylamino]benzoate.
| Compound Name | methyl 4-[3-[3-hydroxy-2-propyl-4-(2,2,2-trifluoroethanimidoyl)phenoxy]propyl-methylamino]benzoate |
|---|---|
| PubChem CID | 143505377 |
| Molecular Formula | C23H27F3N2O4 |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | methyl 4-[3-[3-hydroxy-2-propyl-4-(2,2,2-trifluoroethanimidoyl)phenoxy]propyl-methylamino]benzoate |
| SMILES | [H]/N=C(/c1ccc(OCCCN(C)c2ccc(C(=O)OC)cc2)c(CCC)c1O)C(F)(F)F |
| InChI | InChI=1S/C23H27F3N2O4/c1-4-6-17-19(12-11-18(20(17)29)21(27)23(24,25)26)32-14-5-13-28(2)16-9-7-15(8-10-16)22(30)31-3/h7-12,27,29H,4-6,13-14H2,1-3H3/b27-21- |
| InChIKey | YHSXKVFDJLAMIQ-MEFGMAGPSA-N |
| XLogP | 4.97 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|