C25H32O7 — CID 14986432
4-[6-(3,4-dihydroxy-2,5,6-trimethylphenyl)-6-oxohexoxy]-2-hydroxy-3-propylbenzoic acid (PubChem CID 14986432) has the molecular formula C25H32O7 and a molecular weight of 444.52 g/mol. Its IUPAC name is 4-[6-(3,4-dihydroxy-2,5,6-trimethylphenyl)-6-oxohexoxy]-2-hydroxy-3-propylbenzoic acid.
| Compound Name | 4-[6-(3,4-dihydroxy-2,5,6-trimethylphenyl)-6-oxohexoxy]-2-hydroxy-3-propylbenzoic acid |
|---|---|
| PubChem CID | 14986432 |
| Molecular Formula | C25H32O7 |
| Molecular Weight | 444.52 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | 4-[6-(3,4-dihydroxy-2,5,6-trimethylphenyl)-6-oxohexoxy]-2-hydroxy-3-propylbenzoic acid |
| SMILES | CCCc1c(OCCCCCC(=O)c2c(C)c(C)c(O)c(O)c2C)ccc(C(=O)O)c1O |
| InChI | InChI=1S/C25H32O7/c1-5-9-17-20(12-11-18(24(17)29)25(30)31)32-13-8-6-7-10-19(26)21-14(2)15(3)22(27)23(28)16(21)4/h11-12,27-29H,5-10,13H2,1-4H3,(H,30,31) |
| InChIKey | FZGNZGDVPVQHMO-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.52 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|