C26H36O6 — CID 67864980
4-[6-(2,3-dihydroxyphenyl)decoxy]-2-hydroxy-3-propylbenzoic acid (PubChem CID 67864980) has the molecular formula C26H36O6 and a molecular weight of 444.57 g/mol. Its IUPAC name is 4-[6-(2,3-dihydroxyphenyl)decoxy]-2-hydroxy-3-propylbenzoic acid.
| Compound Name | 4-[6-(2,3-dihydroxyphenyl)decoxy]-2-hydroxy-3-propylbenzoic acid |
|---|---|
| PubChem CID | 67864980 |
| Molecular Formula | C26H36O6 |
| Molecular Weight | 444.57 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | 4-[6-(2,3-dihydroxyphenyl)decoxy]-2-hydroxy-3-propylbenzoic acid |
| SMILES | CCCCC(CCCCCOc1ccc(C(=O)O)c(O)c1CCC)c1cccc(O)c1O |
| InChI | InChI=1S/C26H36O6/c1-3-5-11-18(19-13-9-14-22(27)25(19)29)12-7-6-8-17-32-23-16-15-21(26(30)31)24(28)20(23)10-4-2/h9,13-16,18,27-29H,3-8,10-12,17H2,1-2H3,(H,30,31) |
| InChIKey | SNOXJZLEDYSPEA-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.57 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|