C21H26O6 — CID 67864173
4-[3-(3,4-dihydroxyphenyl)pentoxy]-2-hydroxy-3-propylbenzoic acid (PubChem CID 67864173) has the molecular formula C21H26O6 and a molecular weight of 374.43 g/mol. Its IUPAC name is 4-[3-(3,4-dihydroxyphenyl)pentoxy]-2-hydroxy-3-propylbenzoic acid.
| Compound Name | 4-[3-(3,4-dihydroxyphenyl)pentoxy]-2-hydroxy-3-propylbenzoic acid |
|---|---|
| PubChem CID | 67864173 |
| Molecular Formula | C21H26O6 |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 4-[3-(3,4-dihydroxyphenyl)pentoxy]-2-hydroxy-3-propylbenzoic acid |
| SMILES | CCCc1c(OCCC(CC)c2ccc(O)c(O)c2)ccc(C(=O)O)c1O |
| InChI | InChI=1S/C21H26O6/c1-3-5-15-19(9-7-16(20(15)24)21(25)26)27-11-10-13(4-2)14-6-8-17(22)18(23)12-14/h6-9,12-13,22-24H,3-5,10-11H2,1-2H3,(H,25,26) |
| InChIKey | QYYQRKCAFPLCAV-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|