C21H25ClO5 — CID 154078000
1-[4-(3-chloropropoxy)-2-hydroxy-3-propylphenyl]-2-(3-hydroxy-4-methoxyphenyl)ethanone (PubChem CID 154078000) has the molecular formula C21H25ClO5 and a molecular weight of 392.88 g/mol. Its IUPAC name is 1-[4-(3-chloropropoxy)-2-hydroxy-3-propylphenyl]-2-(3-hydroxy-4-methoxyphenyl)ethanone.
| Compound Name | 1-[4-(3-chloropropoxy)-2-hydroxy-3-propylphenyl]-2-(3-hydroxy-4-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 154078000 |
| Molecular Formula | C21H25ClO5 |
| Molecular Weight | 392.88 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | 1-[4-(3-chloropropoxy)-2-hydroxy-3-propylphenyl]-2-(3-hydroxy-4-methoxyphenyl)ethanone |
| SMILES | CCCc1c(OCCCCl)ccc(C(=O)Cc2ccc(OC)c(O)c2)c1O |
| InChI | InChI=1S/C21H25ClO5/c1-3-5-16-19(27-11-4-10-22)9-7-15(21(16)25)17(23)12-14-6-8-20(26-2)18(24)13-14/h6-9,13,24-25H,3-5,10-12H2,1-2H3 |
| InChIKey | TYXZNDSOEDOREV-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.88 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|