C26H33ClO5 — CID 54396144
2-[3-chloro-4-[3-(3-hydroxy-4-pentanoyl-2-propylphenoxy)propyl]phenyl]propanoic acid (PubChem CID 54396144) has the molecular formula C26H33ClO5 and a molecular weight of 461.00 g/mol. Its IUPAC name is 2-[3-chloro-4-[3-(3-hydroxy-4-pentanoyl-2-propylphenoxy)propyl]phenyl]propanoic acid.
| Compound Name | 2-[3-chloro-4-[3-(3-hydroxy-4-pentanoyl-2-propylphenoxy)propyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 54396144 |
| Molecular Formula | C26H33ClO5 |
| Molecular Weight | 461.00 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | 2-[3-chloro-4-[3-(3-hydroxy-4-pentanoyl-2-propylphenoxy)propyl]phenyl]propanoic acid |
| SMILES | CCCCC(=O)c1ccc(OCCCc2ccc(C(C)C(=O)O)cc2Cl)c(CCC)c1O |
| InChI | InChI=1S/C26H33ClO5/c1-4-6-10-23(28)20-13-14-24(21(8-5-2)25(20)29)32-15-7-9-18-11-12-19(16-22(18)27)17(3)26(30)31/h11-14,16-17,29H,4-10,15H2,1-3H3,(H,30,31) |
| InChIKey | VKBWUIFOILSQAL-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.00 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|