C37H30O9 — CID 10348886
7-[3-(5-hydroxy-4-oxo-2,3-diphenylchromen-7-yl)oxypropoxy]-4-oxo-8-propylchromene-2-carboxylic acid (PubChem CID 10348886) has the molecular formula C37H30O9 and a molecular weight of 618.64 g/mol. Its IUPAC name is 7-[3-(5-hydroxy-4-oxo-2,3-diphenylchromen-7-yl)oxypropoxy]-4-oxo-8-propylchromene-2-carboxylic acid.
| Compound Name | 7-[3-(5-hydroxy-4-oxo-2,3-diphenylchromen-7-yl)oxypropoxy]-4-oxo-8-propylchromene-2-carboxylic acid |
|---|---|
| PubChem CID | 10348886 |
| Molecular Formula | C37H30O9 |
| Molecular Weight | 618.64 g/mol |
| Exact Mass | 618.19 |
| IUPAC Name | 7-[3-(5-hydroxy-4-oxo-2,3-diphenylchromen-7-yl)oxypropoxy]-4-oxo-8-propylchromene-2-carboxylic acid |
| SMILES | CCCc1c(OCCCOc2cc(O)c3c(=O)c(-c4ccccc4)c(-c4ccccc4)oc3c2)ccc2c(=O)cc(C(=O)O)oc12 |
| InChI | InChI=1S/C37H30O9/c1-2-10-26-29(16-15-25-27(38)21-31(37(41)42)46-36(25)26)44-18-9-17-43-24-19-28(39)33-30(20-24)45-35(23-13-7-4-8-14-23)32(34(33)40)22-11-5-3-6-12-22/h3-8,11-16,19-21,39H,2,9-10,17-18H2,1H3,(H,41,42) |
| InChIKey | CIABOOLRVBPBNS-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 136.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.64 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|