C33H48O7Si — CID 90315491
7-butoxy-2-(3,4-dibutoxyphenyl)-5-hydroxy-3-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]chromen-4-one (PubChem CID 90315491) has the molecular formula C33H48O7Si and a molecular weight of 584.83 g/mol. Its IUPAC name is 7-butoxy-2-(3,4-dibutoxyphenyl)-5-hydroxy-3-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]chromen-4-one.
| Compound Name | 7-butoxy-2-(3,4-dibutoxyphenyl)-5-hydroxy-3-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]chromen-4-one |
|---|---|
| PubChem CID | 90315491 |
| Molecular Formula | C33H48O7Si |
| Molecular Weight | 584.83 g/mol |
| Exact Mass | 584.32 |
| IUPAC Name | 7-butoxy-2-(3,4-dibutoxyphenyl)-5-hydroxy-3-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]chromen-4-one |
| SMILES | CCCCOc1cc(O)c2c(=O)c(CC(C)(C)[Si](C)(C)O)c(-c3ccc(OCCCC)c(OCCCC)c3)oc2c1 |
| InChI | InChI=1S/C33H48O7Si/c1-8-11-16-37-24-20-26(34)30-29(21-24)40-32(25(31(30)35)22-33(4,5)41(6,7)36)23-14-15-27(38-17-12-9-2)28(19-23)39-18-13-10-3/h14-15,19-21,34,36H,8-13,16-18,22H2,1-7H3 |
| InChIKey | XJHRQFYHQFYKTK-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 98.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.83 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|