C13H14O3 — CID 91664847
3-ethyl-5-hydroxy-2,7-dimethylchromen-4-one (PubChem CID 91664847) has the molecular formula C13H14O3 and a molecular weight of 218.25 g/mol. Its IUPAC name is 3-ethyl-5-hydroxy-2,7-dimethylchromen-4-one.
| Compound Name | 3-ethyl-5-hydroxy-2,7-dimethylchromen-4-one |
|---|---|
| PubChem CID | 91664847 |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 3-ethyl-5-hydroxy-2,7-dimethylchromen-4-one |
| SMILES | CCc1c(C)oc2cc(C)cc(O)c2c1=O |
| InChI | InChI=1S/C13H14O3/c1-4-9-8(3)16-11-6-7(2)5-10(14)12(11)13(9)15/h5-6,14H,4H2,1-3H3 |
| InChIKey | ICNMFPAIWRHHPW-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |