C16H12O4 — CID 174942178
4,5-dihydroxy-7-methyl-3-phenylchromen-2-one (PubChem CID 174942178) has the molecular formula C16H12O4 and a molecular weight of 268.27 g/mol. Its IUPAC name is 4,5-dihydroxy-7-methyl-3-phenylchromen-2-one.
| Compound Name | 4,5-dihydroxy-7-methyl-3-phenylchromen-2-one |
|---|---|
| PubChem CID | 174942178 |
| Molecular Formula | C16H12O4 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 4,5-dihydroxy-7-methyl-3-phenylchromen-2-one |
| SMILES | Cc1cc(O)c2c(O)c(-c3ccccc3)c(=O)oc2c1 |
| InChI | InChI=1S/C16H12O4/c1-9-7-11(17)14-12(8-9)20-16(19)13(15(14)18)10-5-3-2-4-6-10/h2-8,17-18H,1H3 |
| InChIKey | HHMXYGBLUOXLPN-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|