C17H13IO6 — CID 87579085
7-ethyl-3-hydroxy-5-iodo-2-(3,4,5-trihydroxyphenyl)chromen-4-one (PubChem CID 87579085) has the molecular formula C17H13IO6 and a molecular weight of 440.19 g/mol. Its IUPAC name is 7-ethyl-3-hydroxy-5-iodo-2-(3,4,5-trihydroxyphenyl)chromen-4-one.
| Compound Name | 7-ethyl-3-hydroxy-5-iodo-2-(3,4,5-trihydroxyphenyl)chromen-4-one |
|---|---|
| PubChem CID | 87579085 |
| Molecular Formula | C17H13IO6 |
| Molecular Weight | 440.19 g/mol |
| Exact Mass | 439.98 |
| IUPAC Name | 7-ethyl-3-hydroxy-5-iodo-2-(3,4,5-trihydroxyphenyl)chromen-4-one |
| SMILES | CCc1cc(I)c2c(=O)c(O)c(-c3cc(O)c(O)c(O)c3)oc2c1 |
| InChI | InChI=1S/C17H13IO6/c1-2-7-3-9(18)13-12(4-7)24-17(16(23)15(13)22)8-5-10(19)14(21)11(20)6-8/h3-6,19-21,23H,2H2,1H3 |
| InChIKey | AZPWGAQUMSMJHU-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.19 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|