C30H39NO6 — CID 143788158
5-(tert-butyliminomethyl)-7-decyl-3-hydroxy-2-(3,4,5-trihydroxyphenyl)chromen-4-one (PubChem CID 143788158) has the molecular formula C30H39NO6 and a molecular weight of 509.64 g/mol. Its IUPAC name is 5-(tert-butyliminomethyl)-7-decyl-3-hydroxy-2-(3,4,5-trihydroxyphenyl)chromen-4-one.
| Compound Name | 5-(tert-butyliminomethyl)-7-decyl-3-hydroxy-2-(3,4,5-trihydroxyphenyl)chromen-4-one |
|---|---|
| PubChem CID | 143788158 |
| Molecular Formula | C30H39NO6 |
| Molecular Weight | 509.64 g/mol |
| Exact Mass | 509.28 |
| IUPAC Name | 5-(tert-butyliminomethyl)-7-decyl-3-hydroxy-2-(3,4,5-trihydroxyphenyl)chromen-4-one |
| SMILES | CCCCCCCCCCc1cc(/C=N/C(C)(C)C)c2c(=O)c(O)c(-c3cc(O)c(O)c(O)c3)oc2c1 |
| InChI | InChI=1S/C30H39NO6/c1-5-6-7-8-9-10-11-12-13-19-14-21(18-31-30(2,3)4)25-24(15-19)37-29(28(36)27(25)35)20-16-22(32)26(34)23(33)17-20/h14-18,32-34,36H,5-13H2,1-4H3/b31-18+ |
| InChIKey | KKRDNFNMHVWVNB-FDAWAROLSA-N |
| XLogP | 7.18 |
| TPSA | 123.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.64 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|