C22H24O6 — CID 159428270
1-[(E)-hept-2-enyl]-2,8-dihydroxy-3,6-dimethoxyxanthen-9-one (PubChem CID 159428270) has the molecular formula C22H24O6 and a molecular weight of 384.43 g/mol. Its IUPAC name is 1-[(E)-hept-2-enyl]-2,8-dihydroxy-3,6-dimethoxyxanthen-9-one.
| Compound Name | 1-[(E)-hept-2-enyl]-2,8-dihydroxy-3,6-dimethoxyxanthen-9-one |
|---|---|
| PubChem CID | 159428270 |
| Molecular Formula | C22H24O6 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 1-[(E)-hept-2-enyl]-2,8-dihydroxy-3,6-dimethoxyxanthen-9-one |
| SMILES | CCCC/C=C/Cc1c(O)c(OC)cc2oc3cc(OC)cc(O)c3c(=O)c12 |
| InChI | InChI=1S/C22H24O6/c1-4-5-6-7-8-9-14-19-17(12-18(27-3)21(14)24)28-16-11-13(26-2)10-15(23)20(16)22(19)25/h7-8,10-12,23-24H,4-6,9H2,1-3H3/b8-7+ |
| InChIKey | LQQPLOXKMLNQPI-BQYQJAHWSA-N |
| XLogP | 4.66 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|