C27H31NO7 — CID 3834606
[4-(4-methoxyphenyl)-8-methyl-2-oxochromen-7-yl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate (PubChem CID 3834606) has the molecular formula C27H31NO7 and a molecular weight of 481.55 g/mol. Its IUPAC name is [4-(4-methoxyphenyl)-8-methyl-2-oxochromen-7-yl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate.
| Compound Name | [4-(4-methoxyphenyl)-8-methyl-2-oxochromen-7-yl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
|---|---|
| PubChem CID | 3834606 |
| Molecular Formula | C27H31NO7 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | [4-(4-methoxyphenyl)-8-methyl-2-oxochromen-7-yl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
| SMILES | CCCC(NC(=O)OC(C)(C)C)C(=O)Oc1ccc2c(-c3ccc(OC)cc3)cc(=O)oc2c1C |
| InChI | InChI=1S/C27H31NO7/c1-7-8-21(28-26(31)35-27(3,4)5)25(30)33-22-14-13-19-20(15-23(29)34-24(19)16(22)2)17-9-11-18(32-6)12-10-17/h9-15,21H,7-8H2,1-6H3,(H,28,31) |
| InChIKey | GIARPTIUGIJZTK-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 104.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|