C33H32N2O7 — CID 5235300
[4-(4-methoxyphenyl)-8-methyl-2-oxochromen-7-yl] 3-(1H-indol-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 5235300) has the molecular formula C33H32N2O7 and a molecular weight of 568.63 g/mol. Its IUPAC name is [4-(4-methoxyphenyl)-8-methyl-2-oxochromen-7-yl] 3-(1H-indol-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | [4-(4-methoxyphenyl)-8-methyl-2-oxochromen-7-yl] 3-(1H-indol-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 5235300 |
| Molecular Formula | C33H32N2O7 |
| Molecular Weight | 568.63 g/mol |
| Exact Mass | 568.22 |
| IUPAC Name | [4-(4-methoxyphenyl)-8-methyl-2-oxochromen-7-yl] 3-(1H-indol-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | COc1ccc(-c2cc(=O)oc3c(C)c(OC(=O)C(Cc4c[nH]c5ccccc45)NC(=O)OC(C)(C)C)ccc23)cc1 |
| InChI | InChI=1S/C33H32N2O7/c1-19-28(15-14-24-25(17-29(36)41-30(19)24)20-10-12-22(39-5)13-11-20)40-31(37)27(35-32(38)42-33(2,3)4)16-21-18-34-26-9-7-6-8-23(21)26/h6-15,17-18,27,34H,16H2,1-5H3,(H,35,38) |
| InChIKey | QTHTZERBUDCFLG-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 119.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.63 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|