C26H38N2O5P2 — CID 171590246
3-[2-[[di(propan-2-yl)amino]-(ethyliminomethylphosphanyl)phosphanyl]oxyethoxymethyl]-2,5,9-trimethylfuro[3,2-g]chromen-7-one (PubChem CID 171590246) has the molecular formula C26H38N2O5P2 and a molecular weight of 520.55 g/mol. Its IUPAC name is 3-[2-[[di(propan-2-yl)amino]-(ethyliminomethylphosphanyl)phosphanyl]oxyethoxymethyl]-2,5,9-trimethylfuro[3,2-g]chromen-7-one.
| Compound Name | 3-[2-[[di(propan-2-yl)amino]-(ethyliminomethylphosphanyl)phosphanyl]oxyethoxymethyl]-2,5,9-trimethylfuro[3,2-g]chromen-7-one |
|---|---|
| PubChem CID | 171590246 |
| Molecular Formula | C26H38N2O5P2 |
| Molecular Weight | 520.55 g/mol |
| Exact Mass | 520.23 |
| IUPAC Name | 3-[2-[[di(propan-2-yl)amino]-(ethyliminomethylphosphanyl)phosphanyl]oxyethoxymethyl]-2,5,9-trimethylfuro[3,2-g]chromen-7-one |
| SMILES | CC/N=C/PP(OCCOCc1c(C)oc2c(C)c3oc(=O)cc(C)c3cc12)N(C(C)C)C(C)C |
| InChI | InChI=1S/C26H38N2O5P2/c1-9-27-15-34-35(28(16(2)3)17(4)5)31-11-10-30-14-23-20(8)32-26-19(7)25-21(13-22(23)26)18(6)12-24(29)33-25/h12-13,15-17,34H,9-11,14H2,1-8H3/b27-15+ |
| InChIKey | MNUGAILSIOWFKG-JFLMPSFJSA-N |
| XLogP | 7.07 |
| TPSA | 77.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.55 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|