C25H38N4O3 — CID 11711918
3-[[3-[4-(3-aminopropylamino)butylamino]propylamino]methyl]-2,5,9-trimethylfuro[3,2-g]chromen-7-one (PubChem CID 11711918) has the molecular formula C25H38N4O3 and a molecular weight of 442.60 g/mol. Its IUPAC name is 3-[[3-[4-(3-aminopropylamino)butylamino]propylamino]methyl]-2,5,9-trimethylfuro[3,2-g]chromen-7-one.
| Compound Name | 3-[[3-[4-(3-aminopropylamino)butylamino]propylamino]methyl]-2,5,9-trimethylfuro[3,2-g]chromen-7-one |
|---|---|
| PubChem CID | 11711918 |
| Molecular Formula | C25H38N4O3 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.29 |
| IUPAC Name | 3-[[3-[4-(3-aminopropylamino)butylamino]propylamino]methyl]-2,5,9-trimethylfuro[3,2-g]chromen-7-one |
| SMILES | Cc1oc2c(C)c3oc(=O)cc(C)c3cc2c1CNCCCNCCCCNCCCN |
| InChI | InChI=1S/C25H38N4O3/c1-17-14-23(30)32-24-18(2)25-21(15-20(17)24)22(19(3)31-25)16-29-13-7-12-28-10-5-4-9-27-11-6-8-26/h14-15,27-29H,4-13,16,26H2,1-3H3 |
| InChIKey | NEEBPWUUDHXREK-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 105.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|