C20H16O4 — CID 707772
5-(4-methoxyphenyl)-3,9-dimethylfuro[3,2-g]chromen-7-one (PubChem CID 707772) has the molecular formula C20H16O4 and a molecular weight of 320.34 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-3,9-dimethylfuro[3,2-g]chromen-7-one.
| Compound Name | 5-(4-methoxyphenyl)-3,9-dimethylfuro[3,2-g]chromen-7-one |
|---|---|
| PubChem CID | 707772 |
| Molecular Formula | C20H16O4 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 5-(4-methoxyphenyl)-3,9-dimethylfuro[3,2-g]chromen-7-one |
| SMILES | COc1ccc(-c2cc(=O)oc3c(C)c4occ(C)c4cc23)cc1 |
| InChI | InChI=1S/C20H16O4/c1-11-10-23-19-12(2)20-17(8-15(11)19)16(9-18(21)24-20)13-4-6-14(22-3)7-5-13/h4-10H,1-3H3 |
| InChIKey | XAMPSLQPWGFHRV-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 52.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|