C19H14O4 — CID 707742
3-(4-methoxyphenyl)-5-methylfuro[3,2-g]chromen-7-one (PubChem CID 707742) has the molecular formula C19H14O4 and a molecular weight of 306.32 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-5-methylfuro[3,2-g]chromen-7-one.
| Compound Name | 3-(4-methoxyphenyl)-5-methylfuro[3,2-g]chromen-7-one |
|---|---|
| PubChem CID | 707742 |
| Molecular Formula | C19H14O4 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 3-(4-methoxyphenyl)-5-methylfuro[3,2-g]chromen-7-one |
| SMILES | COc1ccc(-c2coc3cc4oc(=O)cc(C)c4cc23)cc1 |
| InChI | InChI=1S/C19H14O4/c1-11-7-19(20)23-18-9-17-15(8-14(11)18)16(10-22-17)12-3-5-13(21-2)6-4-12/h3-10H,1-2H3 |
| InChIKey | JJYXDDJOEOVJAD-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 52.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|