C22H23NO6 — CID 4967565
N-(2-methoxyethyl)-2-[4-(4-methoxyphenyl)-8-methyl-2-oxochromen-7-yl]oxyacetamide (PubChem CID 4967565) has the molecular formula C22H23NO6 and a molecular weight of 397.43 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-[4-(4-methoxyphenyl)-8-methyl-2-oxochromen-7-yl]oxyacetamide.
| Compound Name | N-(2-methoxyethyl)-2-[4-(4-methoxyphenyl)-8-methyl-2-oxochromen-7-yl]oxyacetamide |
|---|---|
| PubChem CID | 4967565 |
| Molecular Formula | C22H23NO6 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | N-(2-methoxyethyl)-2-[4-(4-methoxyphenyl)-8-methyl-2-oxochromen-7-yl]oxyacetamide |
| SMILES | COCCNC(=O)COc1ccc2c(-c3ccc(OC)cc3)cc(=O)oc2c1C |
| InChI | InChI=1S/C22H23NO6/c1-14-19(28-13-20(24)23-10-11-26-2)9-8-17-18(12-21(25)29-22(14)17)15-4-6-16(27-3)7-5-15/h4-9,12H,10-11,13H2,1-3H3,(H,23,24) |
| InChIKey | OLBMELDBPGYXDG-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 87.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|