C20H22ClNO5 — CID 45369663
7-hydroxy-8-[(2-methoxyethylamino)methyl]-4-(4-methoxyphenyl)chromen-2-one;hydrochloride (PubChem CID 45369663) has the molecular formula C20H22ClNO5 and a molecular weight of 391.85 g/mol. Its IUPAC name is 7-hydroxy-8-[(2-methoxyethylamino)methyl]-4-(4-methoxyphenyl)chromen-2-one;hydrochloride.
| Compound Name | 7-hydroxy-8-[(2-methoxyethylamino)methyl]-4-(4-methoxyphenyl)chromen-2-one;hydrochloride |
|---|---|
| PubChem CID | 45369663 |
| Molecular Formula | C20H22ClNO5 |
| Molecular Weight | 391.85 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | 7-hydroxy-8-[(2-methoxyethylamino)methyl]-4-(4-methoxyphenyl)chromen-2-one;hydrochloride |
| SMILES | COCCNCc1c(O)ccc2c(-c3ccc(OC)cc3)cc(=O)oc12.Cl |
| InChI | InChI=1S/C20H21NO5.ClH/c1-24-10-9-21-12-17-18(22)8-7-15-16(11-19(23)26-20(15)17)13-3-5-14(25-2)6-4-13;/h3-8,11,21-22H,9-10,12H2,1-2H3;1H |
| InChIKey | YAEMAFMTSDEOSG-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 80.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.85 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|