C21H24ClNO6 — CID 45371422
3-(3,4-dimethoxyphenyl)-7-hydroxy-8-[(2-methoxyethylamino)methyl]chromen-2-one;hydrochloride (PubChem CID 45371422) has the molecular formula C21H24ClNO6 and a molecular weight of 421.88 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-7-hydroxy-8-[(2-methoxyethylamino)methyl]chromen-2-one;hydrochloride.
| Compound Name | 3-(3,4-dimethoxyphenyl)-7-hydroxy-8-[(2-methoxyethylamino)methyl]chromen-2-one;hydrochloride |
|---|---|
| PubChem CID | 45371422 |
| Molecular Formula | C21H24ClNO6 |
| Molecular Weight | 421.88 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-7-hydroxy-8-[(2-methoxyethylamino)methyl]chromen-2-one;hydrochloride |
| SMILES | COCCNCc1c(O)ccc2cc(-c3ccc(OC)c(OC)c3)c(=O)oc12.Cl |
| InChI | InChI=1S/C21H23NO6.ClH/c1-25-9-8-22-12-16-17(23)6-4-14-10-15(21(24)28-20(14)16)13-5-7-18(26-2)19(11-13)27-3;/h4-7,10-11,22-23H,8-9,12H2,1-3H3;1H |
| InChIKey | WWNWVFHFWDHWNV-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 90.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.88 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|