C22H24NO6+ — CID 6983795
3-(3,4-dimethoxyphenyl)-7-hydroxy-8-(morpholin-4-ium-4-ylmethyl)chromen-2-one (PubChem CID 6983795) has the molecular formula C22H24NO6+ and a molecular weight of 398.44 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-7-hydroxy-8-(morpholin-4-ium-4-ylmethyl)chromen-2-one.
| Compound Name | 3-(3,4-dimethoxyphenyl)-7-hydroxy-8-(morpholin-4-ium-4-ylmethyl)chromen-2-one |
|---|---|
| PubChem CID | 6983795 |
| Molecular Formula | C22H24NO6+ |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-7-hydroxy-8-(morpholin-4-ium-4-ylmethyl)chromen-2-one |
| SMILES | COc1ccc(-c2cc3ccc(O)c(C[NH+]4CCOCC4)c3oc2=O)cc1OC |
| InChI | InChI=1S/C22H23NO6/c1-26-19-6-4-14(12-20(19)27-2)16-11-15-3-5-18(24)17(21(15)29-22(16)25)13-23-7-9-28-10-8-23/h3-6,11-12,24H,7-10,13H2,1-2H3/p+1 |
| InChIKey | KBJOQWOPGHRBIG-UHFFFAOYSA-O |
| XLogP | 1.60 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|