C24H27NO7 — CID 6236047
8-[[bis(2-methoxyethyl)amino]methyl]-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-7-hydroxychromen-2-one (PubChem CID 6236047) has the molecular formula C24H27NO7 and a molecular weight of 441.48 g/mol. Its IUPAC name is 8-[[bis(2-methoxyethyl)amino]methyl]-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-7-hydroxychromen-2-one.
| Compound Name | 8-[[bis(2-methoxyethyl)amino]methyl]-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-7-hydroxychromen-2-one |
|---|---|
| PubChem CID | 6236047 |
| Molecular Formula | C24H27NO7 |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | 8-[[bis(2-methoxyethyl)amino]methyl]-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-7-hydroxychromen-2-one |
| SMILES | COCCN(CCOC)Cc1c(O)ccc2cc(-c3ccc4c(c3)OCCO4)c(=O)oc12 |
| InChI | InChI=1S/C24H27NO7/c1-28-9-7-25(8-10-29-2)15-19-20(26)5-3-17-13-18(24(27)32-23(17)19)16-4-6-21-22(14-16)31-12-11-30-21/h3-6,13-14,26H,7-12,15H2,1-2H3 |
| InChIKey | WVJGVQZBDCUVLR-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 90.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|