C23H25NO5 — CID 6221763
8-[[butyl(methyl)amino]methyl]-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-7-hydroxychromen-2-one (PubChem CID 6221763) has the molecular formula C23H25NO5 and a molecular weight of 395.46 g/mol. Its IUPAC name is 8-[[butyl(methyl)amino]methyl]-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-7-hydroxychromen-2-one.
| Compound Name | 8-[[butyl(methyl)amino]methyl]-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-7-hydroxychromen-2-one |
|---|---|
| PubChem CID | 6221763 |
| Molecular Formula | C23H25NO5 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 8-[[butyl(methyl)amino]methyl]-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-7-hydroxychromen-2-one |
| SMILES | CCCCN(C)Cc1c(O)ccc2cc(-c3ccc4c(c3)OCCO4)c(=O)oc12 |
| InChI | InChI=1S/C23H25NO5/c1-3-4-9-24(2)14-18-19(25)7-5-16-12-17(23(26)29-22(16)18)15-6-8-20-21(13-15)28-11-10-27-20/h5-8,12-13,25H,3-4,9-11,14H2,1-2H3 |
| InChIKey | BZOSSQQBRJTVNF-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 72.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|