C24H25NO5 — CID 6217143
8-(azepan-1-ylmethyl)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-7-hydroxychromen-2-one (PubChem CID 6217143) has the molecular formula C24H25NO5 and a molecular weight of 407.47 g/mol. Its IUPAC name is 8-(azepan-1-ylmethyl)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-7-hydroxychromen-2-one.
| Compound Name | 8-(azepan-1-ylmethyl)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-7-hydroxychromen-2-one |
|---|---|
| PubChem CID | 6217143 |
| Molecular Formula | C24H25NO5 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | 8-(azepan-1-ylmethyl)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-7-hydroxychromen-2-one |
| SMILES | O=c1oc2c(CN3CCCCCC3)c(O)ccc2cc1-c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C24H25NO5/c26-20-7-5-17-13-18(16-6-8-21-22(14-16)29-12-11-28-21)24(27)30-23(17)19(20)15-25-9-3-1-2-4-10-25/h5-8,13-14,26H,1-4,9-12,15H2 |
| InChIKey | ITDVJCWYMDXFRH-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 72.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|