C24H22N2O3S — CID 136752880
7-hydroxy-3-(4-phenyl-1,3-thiazol-2-yl)-8-(piperidin-1-ylmethyl)chromen-2-one (PubChem CID 136752880) has the molecular formula C24H22N2O3S and a molecular weight of 418.52 g/mol. Its IUPAC name is 7-hydroxy-3-(4-phenyl-1,3-thiazol-2-yl)-8-(piperidin-1-ylmethyl)chromen-2-one.
| Compound Name | 7-hydroxy-3-(4-phenyl-1,3-thiazol-2-yl)-8-(piperidin-1-ylmethyl)chromen-2-one |
|---|---|
| PubChem CID | 136752880 |
| Molecular Formula | C24H22N2O3S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | 7-hydroxy-3-(4-phenyl-1,3-thiazol-2-yl)-8-(piperidin-1-ylmethyl)chromen-2-one |
| SMILES | O=c1oc2c(CN3CCCCC3)c(O)ccc2cc1-c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C24H22N2O3S/c27-21-10-9-17-13-18(23-25-20(15-30-23)16-7-3-1-4-8-16)24(28)29-22(17)19(21)14-26-11-5-2-6-12-26/h1,3-4,7-10,13,15,27H,2,5-6,11-12,14H2 |
| InChIKey | TVAWGGRFTAWMKD-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 66.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|