C30H25N3O4S — CID 136887044
(1S,9R)-11-[[7-hydroxy-2-oxo-3-(4-phenyl-1,3-thiazol-2-yl)chromen-8-yl]methyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one (PubChem CID 136887044) has the molecular formula C30H25N3O4S and a molecular weight of 523.61 g/mol. Its IUPAC name is (1S,9R)-11-[[7-hydroxy-2-oxo-3-(4-phenyl-1,3-thiazol-2-yl)chromen-8-yl]methyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one.
| Compound Name | (1S,9R)-11-[[7-hydroxy-2-oxo-3-(4-phenyl-1,3-thiazol-2-yl)chromen-8-yl]methyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
|---|---|
| PubChem CID | 136887044 |
| Molecular Formula | C30H25N3O4S |
| Molecular Weight | 523.61 g/mol |
| Exact Mass | 523.16 |
| IUPAC Name | (1S,9R)-11-[[7-hydroxy-2-oxo-3-(4-phenyl-1,3-thiazol-2-yl)chromen-8-yl]methyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
| SMILES | O=c1oc2c(CN3C[C@H]4C[C@@H](C3)c3cccc(=O)n3C4)c(O)ccc2cc1-c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C30H25N3O4S/c34-26-10-9-20-12-22(29-31-24(17-38-29)19-5-2-1-3-6-19)30(36)37-28(20)23(26)16-32-13-18-11-21(15-32)25-7-4-8-27(35)33(25)14-18/h1-10,12,17-18,21,34H,11,13-16H2/t18-,21+/m1/s1 |
| InChIKey | MOQZLWNBVYVNPI-NQIIRXRSSA-N |
| XLogP | 5.07 |
| TPSA | 88.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.61 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|