C28H26N2O5 — CID 131664843
(9R)-11-[[7-hydroxy-3-(3-methoxyphenyl)-2-oxochromen-8-yl]methyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one (PubChem CID 131664843) has the molecular formula C28H26N2O5 and a molecular weight of 470.53 g/mol. Its IUPAC name is (9R)-11-[[7-hydroxy-3-(3-methoxyphenyl)-2-oxochromen-8-yl]methyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one.
| Compound Name | (9R)-11-[[7-hydroxy-3-(3-methoxyphenyl)-2-oxochromen-8-yl]methyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
|---|---|
| PubChem CID | 131664843 |
| Molecular Formula | C28H26N2O5 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | (9R)-11-[[7-hydroxy-3-(3-methoxyphenyl)-2-oxochromen-8-yl]methyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
| SMILES | COc1cccc(-c2cc3ccc(O)c(CN4CC5C[C@H](C4)Cn4c5cccc4=O)c3oc2=O)c1 |
| InChI | InChI=1S/C28H26N2O5/c1-34-21-5-2-4-18(11-21)22-12-19-8-9-25(31)23(27(19)35-28(22)33)16-29-13-17-10-20(15-29)24-6-3-7-26(32)30(24)14-17/h2-9,11-12,17,20,31H,10,13-16H2,1H3/t17-,20?/m1/s1 |
| InChIKey | YHKCDUGPWBMDFQ-DIAVIDTQSA-N |
| XLogP | 3.96 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|