C28H24N4O3S — CID 136887119
7-hydroxy-3-(4-phenyl-1,3-thiazol-2-yl)-8-[(4-pyridin-2-ylpiperazin-1-yl)methyl]chromen-2-one (PubChem CID 136887119) has the molecular formula C28H24N4O3S and a molecular weight of 496.59 g/mol. Its IUPAC name is 7-hydroxy-3-(4-phenyl-1,3-thiazol-2-yl)-8-[(4-pyridin-2-ylpiperazin-1-yl)methyl]chromen-2-one.
| Compound Name | 7-hydroxy-3-(4-phenyl-1,3-thiazol-2-yl)-8-[(4-pyridin-2-ylpiperazin-1-yl)methyl]chromen-2-one |
|---|---|
| PubChem CID | 136887119 |
| Molecular Formula | C28H24N4O3S |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | 7-hydroxy-3-(4-phenyl-1,3-thiazol-2-yl)-8-[(4-pyridin-2-ylpiperazin-1-yl)methyl]chromen-2-one |
| SMILES | O=c1oc2c(CN3CCN(c4ccccn4)CC3)c(O)ccc2cc1-c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C28H24N4O3S/c33-24-10-9-20-16-21(27-30-23(18-36-27)19-6-2-1-3-7-19)28(34)35-26(20)22(24)17-31-12-14-32(15-13-31)25-8-4-5-11-29-25/h1-11,16,18,33H,12-15,17H2 |
| InChIKey | FGBIKCXMRYVJDV-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|