C23H24N2O6 — CID 6217414
3-(1,3-benzodioxol-5-yl)-7-hydroxy-8-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]chromen-2-one (PubChem CID 6217414) has the molecular formula C23H24N2O6 and a molecular weight of 424.45 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-7-hydroxy-8-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]chromen-2-one.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-7-hydroxy-8-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]chromen-2-one |
|---|---|
| PubChem CID | 6217414 |
| Molecular Formula | C23H24N2O6 |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-7-hydroxy-8-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]chromen-2-one |
| SMILES | O=c1oc2c(CN3CCN(CCO)CC3)c(O)ccc2cc1-c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C23H24N2O6/c26-10-9-24-5-7-25(8-6-24)13-18-19(27)3-1-16-11-17(23(28)31-22(16)18)15-2-4-20-21(12-15)30-14-29-20/h1-4,11-12,26-27H,5-10,13-14H2 |
| InChIKey | ZBRZPGLEIUEILP-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 95.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|