C24H27NO5 — CID 7204977
3-(3,4-dimethoxyphenyl)-7-hydroxy-8-[[(3R)-3-methylpiperidin-1-yl]methyl]chromen-2-one (PubChem CID 7204977) has the molecular formula C24H27NO5 and a molecular weight of 409.48 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-7-hydroxy-8-[[(3R)-3-methylpiperidin-1-yl]methyl]chromen-2-one.
| Compound Name | 3-(3,4-dimethoxyphenyl)-7-hydroxy-8-[[(3R)-3-methylpiperidin-1-yl]methyl]chromen-2-one |
|---|---|
| PubChem CID | 7204977 |
| Molecular Formula | C24H27NO5 |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-7-hydroxy-8-[[(3R)-3-methylpiperidin-1-yl]methyl]chromen-2-one |
| SMILES | COc1ccc(-c2cc3ccc(O)c(CN4CCC[C@@H](C)C4)c3oc2=O)cc1OC |
| InChI | InChI=1S/C24H27NO5/c1-15-5-4-10-25(13-15)14-19-20(26)8-6-17-11-18(24(27)30-23(17)19)16-7-9-21(28-2)22(12-16)29-3/h6-9,11-12,15,26H,4-5,10,13-14H2,1-3H3/t15-/m1/s1 |
| InChIKey | PTGPSLGKLLBYRZ-OAHLLOKOSA-N |
| XLogP | 4.41 |
| TPSA | 72.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|