C23H24O8 — CID 101389724
16-(3,4-dimethoxyphenyl)-2,5,8,11,14-pentaoxatricyclo[10.8.0.013,18]icosa-1(12),13(18),16,19-tetraen-15-one (PubChem CID 101389724) has the molecular formula C23H24O8 and a molecular weight of 428.44 g/mol. Its IUPAC name is 16-(3,4-dimethoxyphenyl)-2,5,8,11,14-pentaoxatricyclo[10.8.0.013,18]icosa-1(12),13(18),16,19-tetraen-15-one.
| Compound Name | 16-(3,4-dimethoxyphenyl)-2,5,8,11,14-pentaoxatricyclo[10.8.0.013,18]icosa-1(12),13(18),16,19-tetraen-15-one |
|---|---|
| PubChem CID | 101389724 |
| Molecular Formula | C23H24O8 |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | 16-(3,4-dimethoxyphenyl)-2,5,8,11,14-pentaoxatricyclo[10.8.0.013,18]icosa-1(12),13(18),16,19-tetraen-15-one |
| SMILES | COc1ccc(-c2cc3ccc4c(c3oc2=O)OCCOCCOCCO4)cc1OC |
| InChI | InChI=1S/C23H24O8/c1-25-18-5-3-15(14-20(18)26-2)17-13-16-4-6-19-22(21(16)31-23(17)24)30-12-10-28-8-7-27-9-11-29-19/h3-6,13-14H,7-12H2,1-2H3 |
| InChIKey | GANUPOLDGWTWQQ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 85.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|