C28H34N2O4 — CID 125428756
8-[[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl-methylamino]methyl]-7-hydroxy-3-(4-methoxyphenyl)chromen-2-one (PubChem CID 125428756) has the molecular formula C28H34N2O4 and a molecular weight of 462.59 g/mol. Its IUPAC name is 8-[[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl-methylamino]methyl]-7-hydroxy-3-(4-methoxyphenyl)chromen-2-one.
| Compound Name | 8-[[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl-methylamino]methyl]-7-hydroxy-3-(4-methoxyphenyl)chromen-2-one |
|---|---|
| PubChem CID | 125428756 |
| Molecular Formula | C28H34N2O4 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | 8-[[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl-methylamino]methyl]-7-hydroxy-3-(4-methoxyphenyl)chromen-2-one |
| SMILES | COc1ccc(-c2cc3ccc(O)c(CN(C)C[C@@H]4CCCN5CCCC[C@H]45)c3oc2=O)cc1 |
| InChI | InChI=1S/C28H34N2O4/c1-29(17-21-6-5-15-30-14-4-3-7-25(21)30)18-24-26(31)13-10-20-16-23(28(32)34-27(20)24)19-8-11-22(33-2)12-9-19/h8-13,16,21,25,31H,3-7,14-15,17-18H2,1-2H3/t21-,25+/m0/s1 |
| InChIKey | XERJQGMUQHINDR-SQJMNOBHSA-N |
| XLogP | 4.87 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|