C24H34N2O3 — CID 125429813
6-[[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl-methylamino]methyl]-5-hydroxy-3,4,7-trimethylchromen-2-one (PubChem CID 125429813) has the molecular formula C24H34N2O3 and a molecular weight of 398.55 g/mol. Its IUPAC name is 6-[[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl-methylamino]methyl]-5-hydroxy-3,4,7-trimethylchromen-2-one.
| Compound Name | 6-[[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl-methylamino]methyl]-5-hydroxy-3,4,7-trimethylchromen-2-one |
|---|---|
| PubChem CID | 125429813 |
| Molecular Formula | C24H34N2O3 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.26 |
| IUPAC Name | 6-[[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl-methylamino]methyl]-5-hydroxy-3,4,7-trimethylchromen-2-one |
| SMILES | Cc1cc2oc(=O)c(C)c(C)c2c(O)c1CN(C)C[C@@H]1CCCN2CCCC[C@H]12 |
| InChI | InChI=1S/C24H34N2O3/c1-15-12-21-22(16(2)17(3)24(28)29-21)23(27)19(15)14-25(4)13-18-8-7-11-26-10-6-5-9-20(18)26/h12,18,20,27H,5-11,13-14H2,1-4H3/t18-,20+/m0/s1 |
| InChIKey | NOTPYNFNJCRKTB-AZUAARDMSA-N |
| XLogP | 4.12 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|