C25H36N2O4 — CID 125427746
8-[[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl-(2-methoxyethyl)amino]methyl]-7-hydroxy-3,4-dimethylchromen-2-one (PubChem CID 125427746) has the molecular formula C25H36N2O4 and a molecular weight of 428.57 g/mol. Its IUPAC name is 8-[[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl-(2-methoxyethyl)amino]methyl]-7-hydroxy-3,4-dimethylchromen-2-one.
| Compound Name | 8-[[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl-(2-methoxyethyl)amino]methyl]-7-hydroxy-3,4-dimethylchromen-2-one |
|---|---|
| PubChem CID | 125427746 |
| Molecular Formula | C25H36N2O4 |
| Molecular Weight | 428.57 g/mol |
| Exact Mass | 428.27 |
| IUPAC Name | 8-[[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl-(2-methoxyethyl)amino]methyl]-7-hydroxy-3,4-dimethylchromen-2-one |
| SMILES | COCCN(Cc1c(O)ccc2c(C)c(C)c(=O)oc12)C[C@@H]1CCCN2CCCC[C@H]12 |
| InChI | InChI=1S/C25H36N2O4/c1-17-18(2)25(29)31-24-20(17)9-10-23(28)21(24)16-26(13-14-30-3)15-19-7-6-12-27-11-5-4-8-22(19)27/h9-10,19,22,28H,4-8,11-16H2,1-3H3/t19-,22+/m0/s1 |
| InChIKey | FGBIXBWMQSNIMN-SIKLNZKXSA-N |
| XLogP | 3.83 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.57 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|