C26H38N2O4 — CID 125427762
6-[[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl-(2-methoxyethyl)amino]methyl]-5-hydroxy-3,4,7-trimethylchromen-2-one (PubChem CID 125427762) has the molecular formula C26H38N2O4 and a molecular weight of 442.60 g/mol. Its IUPAC name is 6-[[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl-(2-methoxyethyl)amino]methyl]-5-hydroxy-3,4,7-trimethylchromen-2-one.
| Compound Name | 6-[[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl-(2-methoxyethyl)amino]methyl]-5-hydroxy-3,4,7-trimethylchromen-2-one |
|---|---|
| PubChem CID | 125427762 |
| Molecular Formula | C26H38N2O4 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.28 |
| IUPAC Name | 6-[[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl-(2-methoxyethyl)amino]methyl]-5-hydroxy-3,4,7-trimethylchromen-2-one |
| SMILES | COCCN(Cc1c(C)cc2oc(=O)c(C)c(C)c2c1O)C[C@@H]1CCCN2CCCC[C@H]12 |
| InChI | InChI=1S/C26H38N2O4/c1-17-14-23-24(18(2)19(3)26(30)32-23)25(29)21(17)16-27(12-13-31-4)15-20-8-7-11-28-10-6-5-9-22(20)28/h14,20,22,29H,5-13,15-16H2,1-4H3/t20-,22+/m0/s1 |
| InChIKey | FZNBYZGQXNKAJR-RBBKRZOGSA-N |
| XLogP | 4.14 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|