C23H37N3 — CID 56908611
1-[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]-N-methyl-N-[[2-(pyrrolidin-1-ylmethyl)phenyl]methyl]methanamine (PubChem CID 56908611) has the molecular formula C23H37N3 and a molecular weight of 355.57 g/mol. Its IUPAC name is 1-[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]-N-methyl-N-[[2-(pyrrolidin-1-ylmethyl)phenyl]methyl]methanamine.
| Compound Name | 1-[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]-N-methyl-N-[[2-(pyrrolidin-1-ylmethyl)phenyl]methyl]methanamine |
|---|---|
| PubChem CID | 56908611 |
| Molecular Formula | C23H37N3 |
| Molecular Weight | 355.57 g/mol |
| Exact Mass | 355.30 |
| IUPAC Name | 1-[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]-N-methyl-N-[[2-(pyrrolidin-1-ylmethyl)phenyl]methyl]methanamine |
| SMILES | CN(Cc1ccccc1CN1CCCC1)C[C@@H]1CCCN2CCCC[C@H]12 |
| InChI | InChI=1S/C23H37N3/c1-24(18-22-11-8-16-26-15-5-4-12-23(22)26)17-20-9-2-3-10-21(20)19-25-13-6-7-14-25/h2-3,9-10,22-23H,4-8,11-19H2,1H3/t22-,23+/m0/s1 |
| InChIKey | PCVLHUQDSYKNNP-XZOQPEGZSA-N |
| XLogP | 3.98 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.57 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |