C22H32N4 — CID 46987532
1-[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]-N-methyl-N-[[1-(2-methylphenyl)pyrazol-4-yl]methyl]methanamine (PubChem CID 46987532) has the molecular formula C22H32N4 and a molecular weight of 352.53 g/mol. Its IUPAC name is 1-[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]-N-methyl-N-[[1-(2-methylphenyl)pyrazol-4-yl]methyl]methanamine.
| Compound Name | 1-[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]-N-methyl-N-[[1-(2-methylphenyl)pyrazol-4-yl]methyl]methanamine |
|---|---|
| PubChem CID | 46987532 |
| Molecular Formula | C22H32N4 |
| Molecular Weight | 352.53 g/mol |
| Exact Mass | 352.26 |
| IUPAC Name | 1-[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]-N-methyl-N-[[1-(2-methylphenyl)pyrazol-4-yl]methyl]methanamine |
| SMILES | Cc1ccccc1-n1cc(CN(C)C[C@@H]2CCCN3CCCC[C@H]23)cn1 |
| InChI | InChI=1S/C22H32N4/c1-18-8-3-4-10-21(18)26-16-19(14-23-26)15-24(2)17-20-9-7-13-25-12-6-5-11-22(20)25/h3-4,8,10,14,16,20,22H,5-7,9,11-13,15,17H2,1-2H3/t20-,22+/m0/s1 |
| InChIKey | CHFAHCRPGWEETL-RBBKRZOGSA-N |
| XLogP | 3.88 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.53 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |