C17H21N3O2 — CID 56759420
N-methyl-N-[[1-(2-methylphenyl)pyrazol-4-yl]methyl]oxolane-3-carboxamide (PubChem CID 56759420) has the molecular formula C17H21N3O2 and a molecular weight of 299.37 g/mol. Its IUPAC name is N-methyl-N-[[1-(2-methylphenyl)pyrazol-4-yl]methyl]oxolane-3-carboxamide.
| Compound Name | N-methyl-N-[[1-(2-methylphenyl)pyrazol-4-yl]methyl]oxolane-3-carboxamide |
|---|---|
| PubChem CID | 56759420 |
| Molecular Formula | C17H21N3O2 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | N-methyl-N-[[1-(2-methylphenyl)pyrazol-4-yl]methyl]oxolane-3-carboxamide |
| SMILES | Cc1ccccc1-n1cc(CN(C)C(=O)C2CCOC2)cn1 |
| InChI | InChI=1S/C17H21N3O2/c1-13-5-3-4-6-16(13)20-11-14(9-18-20)10-19(2)17(21)15-7-8-22-12-15/h3-6,9,11,15H,7-8,10,12H2,1-2H3 |
| InChIKey | OFZXUSLPKSGDOJ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |